CAS 885275-35-4
:2-[(1,1-Dimethylethoxy)methyl] 6-(triphenylmethyl) 2,6-piperazinediacetate
Description:
2-[(1,1-Dimethylethoxy)methyl] 6-(triphenylmethyl) 2,6-piperazinediacetate is a chemical compound characterized by its complex structure, which includes a piperazine core substituted with both a triphenylmethyl group and a dimethylethoxy group. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity, including interactions with various receptors or enzymes. The presence of the triphenylmethyl moiety may contribute to its lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the dimethylethoxy group can enhance the compound's stability and reactivity. The acetate functional groups suggest that the compound may participate in esterification or hydrolysis reactions. Overall, this compound's unique structural features may lead to diverse applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.
Formula:C32H38N2O5
InChI:InChI=1S/C32H38N2O5/c1-31(2,3)38-23-37-29(35)19-27-21-33-22-28(34-27)20-30(36)39-32(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-18,27-28,33-34H,19-23H2,1-3H3
InChI key:InChIKey=RTKJSCVLWQWGLA-UHFFFAOYSA-N
SMILES:C(OC(CC1NC(CC(OCOC(C)(C)C)=O)CNC1)=O)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 2,6-Piperazinediacetic acid, (1,1-dimethylethoxy)methyl triphenylmethyl ester
- 2,6-Piperazinediacetic acid, 2-[(1,1-dimethylethoxy)methyl] 6-(triphenylmethyl) ester
- 2,6-Piperazinediaceticacid, (1,1-dimethylethoxy)methyl triphenylmethyl ester (9CI)
- 2-[(1,1-Dimethylethoxy)methyl] 6-(triphenylmethyl) 2,6-piperazinediacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,6-Piperazinediaceticacid, 2-[(1,1-dimethylethoxy)methyl] 6-(triphenylmethyl) ester
CAS:Formula:C32H38N2O5Molecular weight:530.6545
