
CAS 885275-42-3
:1-Propanone, 3-phenyl-1-(2-quinoxalinyl)-
Description:
1-Propanone, 3-phenyl-1-(2-quinoxalinyl)-, also known by its CAS number 885275-42-3, is an organic compound characterized by its ketone functional group and the presence of both phenyl and quinoxaline moieties. This compound typically exhibits a molecular structure that includes a propanone backbone, which contributes to its reactivity and potential applications in organic synthesis. The phenyl group enhances its aromatic characteristics, while the quinoxaline ring system may impart unique electronic properties and biological activity. In terms of physical properties, compounds of this nature often display moderate solubility in organic solvents and may have specific melting and boiling points influenced by their molecular interactions. The presence of multiple functional groups suggests potential for diverse chemical reactivity, making it of interest in fields such as medicinal chemistry and materials science. Safety and handling considerations should be taken into account, as with many organic compounds, to ensure proper laboratory practices.
Formula:C17H14N2O
InChI:InChI=1S/C17H14N2O/c20-17(11-10-13-6-2-1-3-7-13)16-12-18-14-8-4-5-9-15(14)19-16/h1-9,12H,10-11H2
InChI key:InChIKey=SPTLQADZHGOUPT-UHFFFAOYSA-N
SMILES:C(CCC1=CC=CC=C1)(=O)C2=NC3=C(N=C2)C=CC=C3
Synonyms:- 3-Phenyl-1-(quinoxalin-2-yl)propan-1-one
- 1-Propanone, 3-phenyl-1-(2-quinoxalinyl)-
- 3-Phenyl-1-quinoxalin-2-yl-propan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
