CymitQuimica logo

CAS 885275-55-8

:

5-chloro-2-methylimidazo[1,2-a]pyridine-3-carboxylic acid

Description:
5-Chloro-2-methylimidazo[1,2-a]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates both nitrogen and chlorine atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the chlorine atom at the 5-position and a methyl group at the 2-position of the imidazo ring influences its reactivity and potential biological activity. It is often studied for its role in various chemical reactions and its implications in fields such as medicinal chemistry and toxicology. The compound may exhibit specific interactions with biological systems, making it of interest in research related to carcinogenicity, as imidazo compounds are often associated with mutagenic properties. Its solubility, stability, and reactivity can vary depending on environmental conditions, such as pH and temperature. Overall, 5-chloro-2-methylimidazo[1,2-a]pyridine-3-carboxylic acid represents a significant compound for further investigation in both synthetic and applied chemistry contexts.
Formula:C9H7ClN2O2
InChI:InChI=1/C9H7ClN2O2/c1-5-8(9(13)14)12-6(10)3-2-4-7(12)11-5/h2-4H,1H3,(H,13,14)
SMILES:Cc1c(C(=O)O)n2c(cccc2n1)Cl
Synonyms:
  • Imidazo[1,2-A]Pyridine-3-Carboxylic Acid, 5-Chloro-2-Methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.