CAS 885275-57-0
:4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-1-piperidineacetic acid
Description:
4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-1-piperidineacetic acid, with the CAS number 885275-57-0, is a chemical compound characterized by its complex structure that includes a piperidine ring, an amino acid moiety, and a dimethylethoxycarbonyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it potentially useful in various biochemical applications. The presence of the piperidine ring contributes to its basicity, while the carboxylic acid group imparts acidic characteristics. The dimethylethoxycarbonyl group serves as a protective group in synthetic chemistry, enhancing the compound's stability and reactivity under specific conditions. Additionally, the para-substituted methylphenyl group can influence the compound's lipophilicity and biological activity. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features that could interact with biological targets. However, specific applications and biological activities would require further investigation and characterization.
Formula:C19H28N2O4
InChI:InChI=1S/C19H28N2O4/c1-13-5-7-14(8-6-13)16(17(22)23)21-11-9-15(10-12-21)20-18(24)25-19(2,3)4/h5-8,15-16H,9-12H2,1-4H3,(H,20,24)(H,22,23)
InChI key:InChIKey=QTTIAGDPSVQPJM-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CCC(NC(OC(C)(C)C)=O)CC1)C2=CC=C(C)C=C2
Synonyms:- 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-1-piperidineacetic acid
- (4-BOC-AMINO-PIPERIDIN-1-YL)-P-TOLYL-ACETIC ACID
- 1-Piperidineacetic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-((tert-Butoxycarbonyl)amino)piperidin-1-yl)-2-(p-tolyl)acetic acid
CAS:Formula:C19H28N2O4Molecular weight:348.4366
