
CAS 885275-63-8
:α-2-Benzofuranyl-4-[(1,1-dimethylethoxy)carbonyl]-1-piperazineacetic acid
Description:
α-2-Benzofuranyl-4-[(1,1-dimethylethoxy)carbonyl]-1-piperazineacetic acid, identified by its CAS number 885275-63-8, is a chemical compound characterized by its complex structure that includes a benzofuran moiety, a piperazine ring, and an acetic acid functional group. This compound typically exhibits properties associated with both its aromatic and aliphatic components, contributing to its potential biological activity. The presence of the dimethylethoxycarbonyl group suggests it may have enhanced lipophilicity, which can influence its solubility and permeability in biological systems. The piperazine ring is often associated with pharmacological activity, making this compound of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for various applications, including drug development or as a biochemical probe. As with many synthetic compounds, understanding its stability, reactivity, and interaction with biological targets would be crucial for assessing its potential uses.
Formula:C19H24N2O5
InChI:InChI=1S/C19H24N2O5/c1-19(2,3)26-18(24)21-10-8-20(9-11-21)16(17(22)23)15-12-13-6-4-5-7-14(13)25-15/h4-7,12,16H,8-11H2,1-3H3,(H,22,23)
InChI key:InChIKey=GIZPNRGDVRHGSI-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC=2C(O1)=CC=CC2)N3CCN(C(OC(C)(C)C)=O)CC3
Synonyms:- 1-Piperazineacetic acid, α-2-benzofuranyl-4-[(1,1-dimethylethoxy)carbonyl]-
- α-2-Benzofuranyl-4-[(1,1-dimethylethoxy)carbonyl]-1-piperazineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Piperazineaceticacid, a-2-benzofuranyl-4-[(1,1-dimethylethoxy)carbonyl]-
CAS:Formula:C19H24N2O5Molecular weight:360.4043
