CAS 885275-64-9
:Pyrazolo[1,5-a]pyridine-7-methanol
Description:
Pyrazolo[1,5-a]pyridine-7-methanol is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyridine rings. This compound features a hydroxymethyl group (-CH2OH) at the 7-position of the pyrazolo ring, contributing to its potential reactivity and solubility in various solvents. Pyrazolo[1,5-a]pyridine derivatives are of interest in medicinal chemistry due to their biological activities, including potential anti-inflammatory, analgesic, and antitumor properties. The presence of the hydroxymethyl group may enhance its interaction with biological targets, making it a candidate for further pharmacological studies. Additionally, the compound's molecular structure allows for various synthetic modifications, which can lead to the development of new derivatives with tailored properties. Its CAS number, 885275-64-9, facilitates its identification in chemical databases and literature, aiding researchers in locating relevant information for synthesis and application. Overall, Pyrazolo[1,5-a]pyridine-7-methanol represents a significant compound in the field of organic and medicinal chemistry.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c11-6-8-3-1-2-7-4-5-9-10(7)8/h1-5,11H,6H2
InChI key:InChIKey=DSWNRZBEGALMPV-UHFFFAOYSA-N
SMILES:C(O)C=1N2C(=CC=N2)C=CC1
Synonyms:- Pyrazolo[1,5-A]Pyridine-7-Methanol
- [Pyrazolo[1,5-a]pyridin-7-yl]methanol
- 4,5,8,7-Tetrahydropyrazolo[1,5-a]pyridin-7-ylmethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
