CAS 885275-93-4

α-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-azetidinyl]-3-pyridineacetic acid

Description:

α-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-azetidinyl]-3-pyridineacetic acid, with CAS number 885275-93-4, is a chemical compound characterized by its unique structural features, which include an azetidine ring and a pyridineacetic acid moiety. This compound typically exhibits properties associated with both its azetidine and pyridine functionalities, such as potential biological activity and solubility in various solvents. The presence of the dimethylethoxycarbonyl group suggests that it may be involved in specific chemical reactions or serve as a protective group in synthetic pathways. Its molecular structure indicates that it may interact with biological targets, making it of interest in pharmaceutical research. Additionally, the compound's stability, reactivity, and potential applications in medicinal chemistry can be influenced by its functional groups and stereochemistry. Overall, this compound represents a complex organic molecule with potential implications in drug development and chemical synthesis.

Formula: C₁₅H₂₁N₃O₄

InChI: InChI=1S/C15H21N3O4/c1-15(2,3)22-14(21)17-11-8-18(9-11)12(13(19)20)10-5-4-6-16-7-10/h4-7,11-12H,8-9H2,1-3H3,(H,17,21)(H,19,20)

InChI key: InChIKey=FZFRLJYWTHBXGV-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N1CC(NC(OC(C)(C)C)=O)C1)C=2C=CC=NC2

Synonyms:

• (3-Boc-Amino-Azetidin-1-Yl)-Pyridin-3-Yl-Acetic Acid
• α-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-azetidinyl]-3-pyridineacetic acid
• 3-Pyridineacetic acid, α-[3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-azetidinyl]-