CAS 885275-96-7
:4-Pyridineacetic acid, a-[3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-azetidinyl]-
Description:
4-Pyridineacetic acid, a-[3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-azetidinyl]- is a chemical compound characterized by its unique structure, which includes a pyridine ring and an azetidine moiety. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has protective or modifying characteristics, often used in organic synthesis to enhance stability or solubility. The azetidine ring adds to the compound's complexity, potentially influencing its biological activity and interaction with other molecules. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 885275-96-7, allows for precise identification in chemical databases and literature. Overall, the combination of these structural elements suggests that this compound could have applications in drug development or as a biochemical tool, although specific biological activities would require further investigation.
Formula:C15H21N3O4
InChI:InChI=1S/C15H21N3O4/c1-15(2,3)22-14(21)17-11-8-18(9-11)12(13(19)20)10-4-6-16-7-5-10/h4-7,11-12H,8-9H2,1-3H3,(H,17,21)(H,19,20)
InChI key:InChIKey=ZRTNFPGXRIXCLM-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CC(NC(OC(C)(C)C)=O)C1)C=2C=CN=CC2
Synonyms:- (3-Boc-Amino-Azetidin-1-Yl)-Pyridin-4-Yl-Acetic Acid
- α-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-azetidinyl]-4-pyridineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.