
CAS 885276-12-0
:3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-furanyl-1-azetidineacetic acid
Description:
3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-furanyl-1-azetidineacetic acid is a chemical compound characterized by its unique structure, which includes an azetidine ring, a furan moiety, and a dimethylethoxycarbonyl group. This compound features a carboxylic acid functional group, contributing to its potential as an acid in various chemical reactions. The presence of the furan ring suggests potential reactivity due to its electron-rich nature, which can participate in electrophilic aromatic substitution or other reactions. The dimethylethoxycarbonyl group serves as a protective group for the amino functionality, enhancing the compound's stability and solubility in organic solvents. Additionally, the azetidine ring introduces strain and can influence the compound's biological activity, making it of interest in medicinal chemistry. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Its specific properties, such as solubility, melting point, and reactivity, would require empirical investigation for detailed characterization.
Formula:C14H20N2O5
InChI:InChI=1S/C14H20N2O5/c1-14(2,3)21-13(19)15-9-7-16(8-9)11(12(17)18)10-5-4-6-20-10/h4-6,9,11H,7-8H2,1-3H3,(H,15,19)(H,17,18)
InChI key:InChIKey=IMJUGIRZIXFUMH-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CC(NC(OC(C)(C)C)=O)C1)C2=CC=CO2
Synonyms:- 1-Azetidineacetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-2-furanyl-
- 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-furanyl-1-azetidineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3-((tert-Butoxycarbonyl)amino)azetidin-1-yl)-2-(furan-2-yl)acetic acid
CAS:Formula:C14H20N2O5Molecular weight:296.3190
