CAS 885276-15-3
:3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-1-pyrrolidineacetic acid
Description:
3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-1-pyrrolidineacetic acid, with the CAS number 885276-15-3, is a synthetic organic compound characterized by its complex structure that includes a pyrrolidine ring, an acetic acid moiety, and a dimethylethoxycarbonyl group. This compound typically exhibits properties such as solubility in polar organic solvents, which is common for compounds containing both hydrophobic and hydrophilic functional groups. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent, given the presence of the amino acid and aromatic components. The compound may also display specific stereochemical configurations, influencing its reactivity and interaction with biological targets. Additionally, it may undergo various chemical reactions, including hydrolysis and amide bond formation, depending on the conditions. Overall, this compound's unique characteristics make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C18H26N2O4
InChI:InChI=1S/C18H26N2O4/c1-12-5-7-13(8-6-12)15(16(21)22)20-10-9-14(11-20)19-17(23)24-18(2,3)4/h5-8,14-15H,9-11H2,1-4H3,(H,19,23)(H,21,22)
InChI key:InChIKey=NYSASCGYJCTPJA-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CC(NC(OC(C)(C)C)=O)CC1)C2=CC=C(C)C=C2
Synonyms:- 1-Pyrrolidineacetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-
- 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-(4-methylphenyl)-1-pyrrolidineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3-((tert-Butoxycarbonyl)amino)pyrrolidin-1-yl)-2-(p-tolyl)acetic acid
CAS:Formula:C18H26N2O4Molecular weight:334.4100
