CymitQuimica logo

CAS 885276-27-7

:

2-(Acetylamino)-2-(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl)propanedioic acid

Description:
2-(Acetylamino)-2-(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl)propanedioic acid, with CAS number 885276-27-7, is a specialized chemical compound characterized by its unique structure that includes both an acetylamino group and a long-chain perfluorinated alkyl group. This compound is likely to exhibit properties typical of fluorinated substances, such as low surface energy, high hydrophobicity, and resistance to chemical degradation. The presence of the propanedioic acid moiety suggests potential for forming hydrogen bonds, which may influence its solubility and reactivity in various environments. Additionally, the extensive fluorination contributes to its thermal stability and potential applications in fields such as surfactants, coatings, or as intermediates in organic synthesis. Due to its complex structure, the compound may also exhibit unique biological interactions, necessitating careful evaluation of its environmental and health impacts. Overall, this compound represents a fascinating intersection of organic chemistry and materials science.
Formula:C18H16F17NO5
InChI:InChI=1S/C18H16F17NO5/c1-7(37)36-10(8(38)39,9(40)41)5-3-2-4-6-11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h2-6H2,1H3,(H,36,37)(H,38,39)(H,40,41)
InChI key:InChIKey=VGSGTZIYXDLEPC-UHFFFAOYSA-N
SMILES:C(CCCCCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(NC(C)=O)(C(O)=O)C(O)=O
Synonyms:
  • 2-(Acetylamino)-2-(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl)propanedioic acid
  • Propanedioic acid, 2-(acetylamino)-2-(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl)-
  • Propanedioic acid, (acetylamino)(6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.