CAS 885276-34-6
:α-2-Benzofuranyl-3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-pyrrolidineacetic acid
Description:
α-2-Benzofuranyl-3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-pyrrolidineacetic acid, with CAS number 885276-34-6, is a synthetic organic compound characterized by its complex structure, which includes a benzofuran moiety and a pyrrolidine ring. This compound features an amino acid derivative with a dimethylethoxycarbonyl group, contributing to its potential as a pharmacological agent. The presence of the benzofuran structure often indicates biological activity, as many compounds with this scaffold exhibit various pharmacological properties, including anti-inflammatory and analgesic effects. The pyrrolidine ring adds to the compound's steric and electronic properties, influencing its interaction with biological targets. Additionally, the carboxylic acid functional group is crucial for solubility and reactivity, making it a candidate for further chemical modifications or as a lead compound in drug development. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, although specific biological activities and therapeutic uses would require further investigation through experimental studies.
Formula:C19H24N2O5
InChI:InChI=1S/C19H24N2O5/c1-19(2,3)26-18(24)20-13-8-9-21(11-13)16(17(22)23)15-10-12-6-4-5-7-14(12)25-15/h4-7,10,13,16H,8-9,11H2,1-3H3,(H,20,24)(H,22,23)
InChI key:InChIKey=UAPKFNWHBNHYLU-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC=2C(O1)=CC=CC2)N3CC(NC(OC(C)(C)C)=O)CC3
Synonyms:- α-2-Benzofuranyl-3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-pyrrolidineacetic acid
- 1-Pyrrolidineacetic acid, α-2-benzofuranyl-3-[[(1,1-dimethylethoxy)carbonyl]amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Benzofuran-2-yl)-2-(3-((tert-butoxycarbonyl)amino)pyrrolidin-1-yl)acetic acid
CAS:Formula:C19H24N2O5Molecular weight:360.4043
