CAS 885276-49-3
:3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-thienyl-1-piperidineacetic acid
Description:
3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-thienyl-1-piperidineacetic acid, with the CAS number 885276-49-3, is a chemical compound that features a piperidine ring, a thienyl group, and an amino acid structure. This compound is characterized by its complex molecular architecture, which includes a dimethylethoxycarbonyl group that enhances its stability and solubility. The presence of the thienyl moiety contributes to its potential biological activity, as thiophene derivatives are often associated with various pharmacological properties. The piperidine ring provides a basic nitrogen atom, which can participate in hydrogen bonding and influence the compound's interaction with biological targets. Additionally, the carboxylic acid functional group at the end of the molecule is crucial for its reactivity and potential as a drug candidate. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways.
Formula:C16H24N2O4S
InChI:InChI=1S/C16H24N2O4S/c1-16(2,3)22-15(21)17-11-6-4-8-18(10-11)13(14(19)20)12-7-5-9-23-12/h5,7,9,11,13H,4,6,8,10H2,1-3H3,(H,17,21)(H,19,20)
InChI key:InChIKey=YRFSUBXXENWVGE-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CC(NC(OC(C)(C)C)=O)CCC1)C2=CC=CS2
Synonyms:- 3-[[(1,1-Dimethylethoxy)carbonyl]amino]-α-2-thienyl-1-piperidineacetic acid
- 1-Piperidineacetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-α-2-thienyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3-((tert-Butoxycarbonyl)amino)piperidin-1-yl)-2-(thiophen-2-yl)acetic acid
CAS:Formula:C16H24N2O4SMolecular weight:340.4378
