CymitQuimica logo

CAS 885276-55-1

:

α-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]-1H-indole-2-acetic acid

Description:
α-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]-1H-indole-2-acetic acid, with CAS number 885276-55-1, is a synthetic organic compound characterized by its complex structure, which includes an indole ring, a piperidine moiety, and an acetic acid functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the dimethylethoxycarbonyl group suggests it may be used in medicinal chemistry, possibly as a prodrug or in the development of pharmaceuticals. Its molecular structure indicates potential for various chemical reactions, including amide formation and esterification. Additionally, the compound may exhibit specific pharmacological activities, making it of interest in drug discovery and development. As with many synthetic compounds, its stability, reactivity, and biological effects would need to be evaluated through experimental studies to fully understand its characteristics and potential applications.
Formula:C20H27N3O4
InChI:InChI=1S/C20H27N3O4/c1-20(2,3)27-19(26)21-14-8-6-10-23(12-14)17(18(24)25)16-11-13-7-4-5-9-15(13)22-16/h4-5,7,9,11,14,17,22H,6,8,10,12H2,1-3H3,(H,21,26)(H,24,25)
InChI key:InChIKey=OTVZQGGULAQQJD-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C1=CC=2C(N1)=CC=CC2)N3CC(NC(OC(C)(C)C)=O)CCC3
Synonyms:
  • α-[3-[[(1,1-Dimethylethoxy)carbonyl]amino]-1-piperidinyl]-1H-indole-2-acetic acid
  • (3-BOC-AMINO-PIPERIDIN-1-YL)-(1H-INDOL-2-YL)-ACETIC ACID
  • 1H-Indole-2-acetic acid, α-[3-[[(1,1-dimethylethoxy)carbonyl]amino]-1-piperidinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.