CAS 885276-65-3
:Methyl 2-(chloromethyl)imidazo[1,2-a]pyridine-8-carboxylate
Description:
Methyl 2-(chloromethyl)imidazo[1,2-a]pyridine-8-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both a carboxylate and a chloromethyl group. This compound typically exhibits a molecular formula that reflects its complex structure, including nitrogen and chlorine atoms, which contribute to its reactivity and potential biological activity. The presence of the chloromethyl group suggests that it may participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. Additionally, the imidazo[1,2-a]pyridine moiety is often associated with various pharmacological properties, potentially making this compound of interest in medicinal chemistry. Its methyl ester functionality indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may further influence its solubility and reactivity. Overall, this compound's unique structural features and functional groups position it as a versatile building block in chemical research and development.
Formula:C10H9ClN2O2
InChI:InChI=1S/C10H9ClN2O2/c1-15-10(14)8-3-2-4-13-6-7(5-11)12-9(8)13/h2-4,6H,5H2,1H3
InChI key:InChIKey=NSPJKKRBWJCDTM-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2N(C=C(CCl)N2)C=CC1
Synonyms:- 2-Chloromethyl-imidazo[1,2-a]pyridine-8-carboxylic acid methyl ester
- Methyl 2-(chloromethyl)imidazo[1,2-a]pyridine-8-carboxylate
- Imidazo[1,2-a]pyridine-8-carboxylic acid, 2-(chloromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-(chloromethyl)imidazo[1,2-a]pyridine-8-carboxylate
CAS:Formula:C10H9ClN2O2Molecular weight:224.6437
