CymitQuimica logo

CAS 885276-72-2

:

8-Nitroimidazo[1,2-a]pyridine-2-carboxaldehyde

Description:
8-Nitroimidazo[1,2-a]pyridine-2-carboxaldehyde is a chemical compound characterized by its unique imidazo-pyridine structure, which incorporates a nitro group and an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. The presence of the nitro group contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and pharmacology. The aldehyde functional group allows for further chemical modifications, enabling the synthesis of derivatives that may exhibit enhanced properties. Additionally, this compound may be studied for its potential applications in the development of antimicrobial agents or other therapeutic agents due to its structural features. As with many nitro-containing compounds, it is essential to handle it with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C8H5N3O3
InChI:InChI=1S/C8H5N3O3/c12-5-6-4-10-3-1-2-7(11(13)14)8(10)9-6/h1-5H
InChI key:InChIKey=VYMSUAHVVCUXPT-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2N(C=C(C=O)N2)C=CC1
Synonyms:
  • 8-Nitro-Imidazo[1,2-A]Pyridine-2-Carbaldehyde
  • 8-Nitroimidazo[1,2-a]pyridine-2-carboxaldehyde
  • Imidazo[1,2-a]pyridine-2-carboxaldehyde, 8-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.