CAS 885276-75-5
:4-(4-Fluorophenyl)-α-3-thienyl-1-piperazineacetic acid
Description:
4-(4-Fluorophenyl)-α-3-thienyl-1-piperazineacetic acid is a chemical compound characterized by its unique structure, which includes a piperazine ring, a thienyl group, and a fluorophenyl moiety. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or altering its pharmacokinetics. The thienyl group contributes to the compound's aromatic character and may also play a role in its interaction with biological targets. As a piperazine derivative, it may exhibit psychoactive properties or act as a ligand for various receptors. The compound's specific applications and effects would depend on its interaction with biological systems, making it of interest in medicinal chemistry and pharmacology. Further studies would be necessary to fully elucidate its characteristics and potential uses.
Formula:C16H17FN2O2S
InChI:InChI=1S/C16H17FN2O2S/c17-13-1-3-14(4-2-13)18-6-8-19(9-7-18)15(16(20)21)12-5-10-22-11-12/h1-5,10-11,15H,6-9H2,(H,20,21)
InChI key:InChIKey=AAXZOCCYGLKPGR-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CCN(CC1)C2=CC=C(F)C=C2)C=3C=CSC3
Synonyms:- 1-Piperazineacetic acid, 4-(4-fluorophenyl)-α-3-thienyl-
- 4-(4-Fluorophenyl)-α-3-thienyl-1-piperazineacetic acid
- [4-(4-Fluoro-Phenyl)-Piperazin-1-Yl]-Thiophen-3-Yl-Acetic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[4-(4-Fluorophenyl)piperazin-1-yl]-2-(thiophen-3-yl)acetic acid
CAS:<p>2-[4-(4-Fluorophenyl)piperazin-1-yl]-2-(thiophen-3-yl)acetic acid</p>Molecular weight:320.38178g/mol

