CymitQuimica logo

CAS 885276-83-5

:

8-(Phenylmethoxy)imidazo[1,2-a]pyridine-2-acetic acid

Description:
8-(Phenylmethoxy)imidazo[1,2-a]pyridine-2-acetic acid is a chemical compound characterized by its unique imidazo-pyridine structure, which incorporates both an imidazole and a pyridine ring. This compound features a phenylmethoxy group, which enhances its lipophilicity and may influence its biological activity. The presence of the acetic acid moiety suggests potential interactions with biological systems, possibly acting as a ligand or modulator in various biochemical pathways. The compound's molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or enzymes. Its CAS number, 885276-83-5, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential uses. As with many compounds in this class, understanding its solubility, stability, and reactivity is crucial for its application in research and development. Overall, 8-(Phenylmethoxy)imidazo[1,2-a]pyridine-2-acetic acid represents a versatile scaffold for further exploration in drug discovery and development.
Formula:C16H14N2O3
InChI:InChI=1S/C16H14N2O3/c19-15(20)9-13-10-18-8-4-7-14(16(18)17-13)21-11-12-5-2-1-3-6-12/h1-8,10H,9,11H2,(H,19,20)
InChI key:InChIKey=RZKFRIOIPKRAQV-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2C=3N(C=C(CC(O)=O)N3)C=CC2
Synonyms:
  • (8-Benzyloxy-Imidazo[1,2-A]Pyridin-2-Yl)-Acetic Acid
  • 8-(Phenylmethoxy)imidazo[1,2-a]pyridine-2-acetic acid
  • Imidazo[1,2-a]pyridine-2-acetic acid, 8-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.