CymitQuimica logo

CAS 885276-93-7

:

Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 5-bromo-, ethyl ester

Description:
Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 5-bromo-, ethyl ester is a chemical compound characterized by its unique pyrazolo-pyridine structure, which features a fused ring system that includes both pyrazole and pyridine moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the bromine atom at the 5-position of the pyridine ring can influence its reactivity and solubility, while the ethyl ester group enhances its lipophilicity, potentially improving its pharmacokinetic properties. The carboxylic acid functionality allows for further chemical modifications, which can be useful in drug development. Additionally, compounds of this nature may exhibit various biological activities, including anti-inflammatory or antimicrobial properties, although specific biological data would depend on empirical studies. Overall, this compound represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C10H9BrN2O2
InChI:InChI=1S/C10H9BrN2O2/c1-2-15-10(14)8-6-12-13-4-3-7(11)5-9(8)13/h3-6H,2H2,1H3
InChI key:InChIKey=LJKZKCQPVABNLG-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(N=C1)C=CC(Br)=C2
Synonyms:
  • Ethyl 5-bromopyrazolo[1,5-a]pyridine-3-carboxylate
  • Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 5-bromo-, ethyl ester
Found 4 products.