CymitQuimica logo

CAS 885276-97-1

:

6-(2-Aminophenyl)-2-pyridinecarboxylic acid

Description:
6-(2-Aminophenyl)-2-pyridinecarboxylic acid, identified by its CAS number 885276-97-1, is an organic compound characterized by its dual functional groups: an amino group and a carboxylic acid group, both of which contribute to its chemical reactivity and potential biological activity. The presence of the pyridine ring provides aromatic stability and can influence the compound's interaction with biological targets. This substance is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with amino and carboxylic acid groups are often involved in enzyme inhibition or receptor binding. Additionally, the compound may exhibit properties such as acidity, basicity, and the ability to form hydrogen bonds, which are critical for its interactions in biological systems. Overall, 6-(2-Aminophenyl)-2-pyridinecarboxylic acid is of interest for its potential roles in drug design and development.
Formula:C12H10N2O2
InChI:InChI=1S/C12H10N2O2/c13-9-5-2-1-4-8(9)10-6-3-7-11(14-10)12(15)16/h1-7H,13H2,(H,15,16)
InChI key:InChIKey=NOFQODFKSHIMEW-UHFFFAOYSA-N
SMILES:NC1=C(C=2N=C(C(O)=O)C=CC2)C=CC=C1
Synonyms:
  • 2-Pyridinecarboxylic acid, 6-(2-aminophenyl)-
  • 6-(2-Aminophenyl)-2-pyridinecarboxylic acid
Found 4 products.