CymitQuimica logo

CAS 885276-98-2

:

4-(4-Chlorophenyl)-α-2-furanyl-1-piperazineacetic acid

Description:
4-(4-Chlorophenyl)-α-2-furanyl-1-piperazineacetic acid, with the CAS number 885276-98-2, is a chemical compound that features a piperazine ring, which is a common motif in pharmacologically active compounds. This substance is characterized by the presence of a chlorophenyl group and a furan moiety, contributing to its potential biological activity. The piperazine structure often imparts properties such as increased solubility and the ability to interact with various biological targets, making it of interest in medicinal chemistry. The acetic acid functional group suggests that it may exhibit acidic properties, which can influence its solubility and reactivity. Additionally, the presence of the furan ring may enhance its ability to participate in various chemical reactions, including electrophilic substitutions. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals, particularly in the development of drugs targeting central nervous system disorders or other therapeutic areas. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C16H17ClN2O3
InChI:InChI=1S/C16H17ClN2O3/c17-12-3-5-13(6-4-12)18-7-9-19(10-8-18)15(16(20)21)14-2-1-11-22-14/h1-6,11,15H,7-10H2,(H,20,21)
InChI key:InChIKey=HRGJPQKVHPAVSZ-UHFFFAOYSA-N
SMILES:C(C(O)=O)(N1CCN(CC1)C2=CC=C(Cl)C=C2)C3=CC=CO3
Synonyms:
  • 1-Piperazineacetic acid, 4-(4-chlorophenyl)-α-2-furanyl-
  • 4-(4-Chlorophenyl)-α-2-furanyl-1-piperazineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.