CAS 885277-09-8
:4-Chloro-6-fluoro-2-phenylquinazoline
Description:
4-Chloro-6-fluoro-2-phenylquinazoline is a synthetic organic compound belonging to the quinazoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyrimidine ring. This compound features a chloro group at the 4-position and a fluoro group at the 6-position, which can influence its reactivity and biological activity. The presence of the phenyl group at the 2-position enhances its lipophilicity, potentially affecting its pharmacokinetic properties. Typically, quinazoline derivatives are of interest in medicinal chemistry due to their diverse biological activities, including anticancer, antimicrobial, and anti-inflammatory properties. The specific substitution pattern of 4-chloro-6-fluoro-2-phenylquinazoline may contribute to its potential as a therapeutic agent, making it a subject of research in drug development. Additionally, its molecular structure suggests that it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, which are common in aromatic compounds. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry.
Formula:C14H8ClFN2
InChI:InChI=1S/C14H8ClFN2/c15-13-11-8-10(16)6-7-12(11)17-14(18-13)9-4-2-1-3-5-9/h1-8H
InChI key:InChIKey=JBWUZXWPJLYAJH-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(N1)C3=CC=CC=C3)C=CC(F)=C2
Synonyms:- Quinazoline, 4-chloro-6-fluoro-2-phenyl-
- QUINAZOLINE, 4-CHLORO-6-FLUORO-2-PHENYL-
- 4-Chloro-6-fluoro-2-phenylquinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Chloro-6-fluoro-2-phenylquinazoline
CAS:<p>4-Chloro-6-fluoro-2-phenylquinazoline</p>Molecular weight:258.67812g/mol


