CAS 885277-19-0
:6-Bromo-4-chloro-2-(4-methoxyphenyl)quinazoline
Description:
6-Bromo-4-chloro-2-(4-methoxyphenyl)quinazoline is a synthetic organic compound belonging to the quinazoline class, characterized by a bicyclic structure that includes a benzene ring fused to a pyrimidine ring. This compound features a bromine atom at the 6-position and a chlorine atom at the 4-position of the quinazoline ring, contributing to its unique reactivity and potential biological activity. The presence of a 4-methoxyphenyl group at the 2-position enhances its lipophilicity and may influence its interaction with biological targets. Typically, quinazoline derivatives are studied for their pharmacological properties, including anticancer and antimicrobial activities. The compound's molecular structure suggests potential for various applications in medicinal chemistry, particularly in the development of targeted therapies. Its specific physical and chemical properties, such as solubility, melting point, and stability, would depend on the conditions under which it is synthesized and stored. As with many halogenated compounds, it may exhibit distinct reactivity patterns, making it of interest in both research and industrial applications.
Formula:C15H10BrClN2O
InChI:InChI=1S/C15H10BrClN2O/c1-20-11-5-2-9(3-6-11)15-18-13-7-4-10(16)8-12(13)14(17)19-15/h2-8H,1H3
InChI key:InChIKey=NBISFDGOTKRYMA-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC2=C1C=C(Br)C=C2)C3=CC=C(OC)C=C3
Synonyms:- Quinazoline, 6-bromo-4-chloro-2-(4-methoxyphenyl)-
- 6-Bromo-4-chloro-2-(4-methoxyphenyl)quinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
