CAS 885277-22-5
:4-Chloro-2-(4-methoxyphenyl)-6-methylquinazoline
Description:
4-Chloro-2-(4-methoxyphenyl)-6-methylquinazoline is a synthetic organic compound characterized by its quinazoline core, which is a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound features a chloro substituent at the 4-position and a methoxyphenyl group at the 2-position, along with a methyl group at the 6-position of the quinazoline ring. The presence of these functional groups contributes to its potential biological activity and pharmacological properties. Typically, compounds of this class may exhibit various activities, including anti-cancer, anti-inflammatory, or antimicrobial effects, making them of interest in medicinal chemistry. The molecular structure influences its solubility, stability, and reactivity, which are critical for its application in drug development. Additionally, the compound's CAS number, 885277-22-5, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.
Formula:C16H13ClN2O
InChI:InChI=1S/C16H13ClN2O/c1-10-3-8-14-13(9-10)15(17)19-16(18-14)11-4-6-12(20-2)7-5-11/h3-9H,1-2H3
InChI key:InChIKey=SBQDBXIVANEOPQ-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC2=C1C=C(C)C=C2)C3=CC=C(OC)C=C3
Synonyms:- 4-Chloro-2-(4-methoxyphenyl)-6-methylquinazoline
- Quinazoline, 4-chloro-2-(4-methoxyphenyl)-6-methyl-
- 4-CHLORO-2-(4-METHOXY-PHENYL)-6-METHYL-QUINAZOLINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
