CAS 885277-25-8
:6-(2-Aminophenyl)-3-pyridinecarbonitrile
Description:
6-(2-Aminophenyl)-3-pyridinecarbonitrile, with the CAS number 885277-25-8, is a chemical compound characterized by its unique structural features, which include a pyridine ring and an amino-substituted phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity due to the presence of the cyano group. The amino group can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. The presence of the pyridine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyridine derivatives are often found in biologically active compounds. Additionally, the cyano group can serve as a versatile functional handle for further chemical modifications. Overall, 6-(2-Aminophenyl)-3-pyridinecarbonitrile is of interest in various fields, including organic synthesis and drug discovery, due to its structural complexity and potential biological activity.
Formula:C12H9N3
InChI:InChI=1S/C12H9N3/c13-7-9-5-6-12(15-8-9)10-3-1-2-4-11(10)14/h1-6,8H,14H2
InChI key:InChIKey=FOXFDPADXRACEV-UHFFFAOYSA-N
SMILES:NC1=C(C=CC=C1)C2=CC=C(C#N)C=N2
Synonyms:- 6-(2-Amino-Phenyl)-Nicotinonitrile
- 6-(2-Aminophenyl)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 6-(2-aminophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
