CAS 885277-27-0
:4-Chloro-7-fluoro-2-(4-methoxyphenyl)quinazoline
Description:
4-Chloro-7-fluoro-2-(4-methoxyphenyl)quinazoline is a synthetic organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a chloro group at the 4-position and a fluoro group at the 7-position, contributing to its unique reactivity and potential biological activity. The presence of a 4-methoxyphenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this class are investigated for their pharmacological properties, including potential anti-cancer or anti-inflammatory activities. The molecular structure suggests that it may engage in hydrogen bonding and π-π stacking interactions, which are crucial for binding to biological macromolecules. Additionally, the presence of halogen atoms often affects the compound's solubility and stability. Overall, 4-Chloro-7-fluoro-2-(4-methoxyphenyl)quinazoline represents a class of compounds with significant interest in medicinal chemistry and drug development.
Formula:C15H10ClFN2O
InChI:InChI=1S/C15H10ClFN2O/c1-20-11-5-2-9(3-6-11)15-18-13-8-10(17)4-7-12(13)14(16)19-15/h2-8H,1H3
InChI key:InChIKey=XNTMFESYQCIMHQ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(N1)C3=CC=C(OC)C=C3)C=C(F)C=C2
Synonyms:- 4-Chloro-7-Fluoro-2-(4-Methoxy-Phenyl)-Quinazoline
- 4-Chloro-7-fluoro-2-(4-methoxyphenyl)quinazoline
- Quinazoline, 4-chloro-7-fluoro-2-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Chloro-7-fluoro-2-(4-methoxyphenyl)quinazoline
CAS:<p>4-Chloro-7-fluoro-2-(4-methoxyphenyl)quinazoline</p>Molecular weight:288.7041g/mol


