CAS 885277-36-1
:5-(Trifluoromethyl)-2-pyridineethanamine
Description:
5-(Trifluoromethyl)-2-pyridineethanamine, identified by its CAS number 885277-36-1, is a chemical compound characterized by the presence of a pyridine ring substituted with a trifluoromethyl group and an ethylamine side chain. This compound typically exhibits properties associated with both aromatic and aliphatic amines, including potential basicity due to the amine functional group. The trifluoromethyl group contributes to its lipophilicity and may influence its reactivity and interaction with biological systems. The presence of the pyridine ring suggests potential applications in medicinal chemistry, as pyridine derivatives are often found in pharmaceuticals. Additionally, the trifluoromethyl group can enhance the compound's metabolic stability and bioavailability. Overall, 5-(Trifluoromethyl)-2-pyridineethanamine is of interest in various fields, including drug development and materials science, due to its unique structural features and potential functional properties.
Formula:C8H9F3N2
InChI:InChI=1S/C8H9F3N2/c9-8(10,11)6-1-2-7(3-4-12)13-5-6/h1-2,5H,3-4,12H2
InChI key:InChIKey=ZYAAOPBQLZKGHH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=CC(CCN)=NC1
Synonyms:- 2-(5-Trifluoromethylpyridin-2-yl)ethylamine
- 2-[5-(Trifluoromethyl)pyridin-2-yl]ethan-1-amine
- 2-[5-(Trifluoromethyl)pyridin-2-yl]ethanamine
- 5-(Trifluoromethyl)-2-pyridineethanamine
- 2-Pyridineethanamine, 5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-[5-(Trifluoromethyl)pyridin-2-yl]ethan-1-amine
CAS:<p>2-[5-(Trifluoromethyl)pyridin-2-yl]ethan-1-amine</p>Molecular weight:190.16567g/mol


