CAS 885277-42-9
:N-(Tetrahydro-2H-pyran-4-yl)-3-pyridinemethanamine
Description:
N-(Tetrahydro-2H-pyran-4-yl)-3-pyridinemethanamine, with the CAS number 885277-42-9, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a tetrahydro-pyran moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the tetrahydro-pyran ring contributes to its cyclic structure, potentially affecting its conformational flexibility and steric interactions. As a pyridine derivative, it may also exhibit biological activity, making it of interest in medicinal chemistry. The compound's molecular interactions can be influenced by the functional groups present, which may play a role in its pharmacological properties. Overall, N-(Tetrahydro-2H-pyran-4-yl)-3-pyridinemethanamine represents a class of compounds that may have applications in drug development or as intermediates in organic synthesis, although specific applications would depend on further research and characterization.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-2-10(8-12-5-1)9-13-11-3-6-14-7-4-11/h1-2,5,8,11,13H,3-4,6-7,9H2
InChI key:InChIKey=ATJWTRSJMKQBAB-UHFFFAOYSA-N
SMILES:C(NC1CCOCC1)C=2C=CC=NC2
Synonyms:- N-(Tetrahydro-2H-pyran-4-yl)-3-pyridinemethanamine
- 3-Pyridinemethanamine, N-(tetrahydro-2H-pyran-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
