CAS 885277-44-1
:4-Chloro-7-fluoro-2-(4-fluorophenyl)quinazoline
Description:
4-Chloro-7-fluoro-2-(4-fluorophenyl)quinazoline is a synthetic organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This particular compound features multiple halogen substituents, specifically chlorine and fluorine atoms, which can significantly influence its chemical properties and biological activity. The presence of the 4-fluorophenyl group enhances its lipophilicity and may contribute to its potential as a pharmacological agent. Compounds like this are often studied for their applications in medicinal chemistry, particularly in the development of targeted therapies for various diseases, including cancer. The specific arrangement of substituents can affect the compound's reactivity, solubility, and interaction with biological targets. Additionally, the compound's CAS number, 885277-44-1, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.
Formula:C14H7ClF2N2
InChI:InChI=1S/C14H7ClF2N2/c15-13-11-6-5-10(17)7-12(11)18-14(19-13)8-1-3-9(16)4-2-8/h1-7H
InChI key:InChIKey=XQFOVHUNMTWLCW-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(N1)C3=CC=C(F)C=C3)C=C(F)C=C2
Synonyms:- 4-Chloro-7-Fluoro-2-(4-Fluoro-Phenyl)-Quinazoline
- 4-Chloro-7-fluoro-2-(4-fluorophenyl)quinazoline
- Quinazoline, 4-chloro-7-fluoro-2-(4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-Chloro-7-fluoro-2-(4-fluorophenyl)quinazoline
CAS:<p>4-Chloro-7-fluoro-2-(4-fluorophenyl)quinazoline</p>Molecular weight:276.66859g/mol


