CAS 885277-45-2
:N-(Tetrahydro-2H-pyran-4-yl)-2-pyridinemethanamine
Description:
N-(Tetrahydro-2H-pyran-4-yl)-2-pyridinemethanamine, with the CAS number 885277-45-2, is a chemical compound characterized by its unique structural features, which include a pyridine ring and a tetrahydropyran moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the tetrahydropyran ring contributes to its cyclic structure, potentially influencing its solubility and reactivity. It may be utilized in various applications, including medicinal chemistry, where its structural characteristics could be relevant for biological activity. The compound's molecular interactions, stability, and potential for forming derivatives are of interest in research contexts. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its practical applications and efficacy in specific chemical reactions or biological systems. Safety data and handling precautions should be considered when working with this substance, as with any chemical compound.
Formula:C11H16N2O
InChI:InChI=1S/C11H16N2O/c1-2-6-12-11(3-1)9-13-10-4-7-14-8-5-10/h1-3,6,10,13H,4-5,7-9H2
InChI key:InChIKey=GEBBFAMFSRNNQG-UHFFFAOYSA-N
SMILES:C(NC1CCOCC1)C2=CC=CC=N2
Synonyms:- 2-Pyridinemethanamine, N-(tetrahydro-2H-pyran-4-yl)-
- N-(Tetrahydro-2H-pyran-4-yl)-2-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
