CAS 885277-51-0
:6-Methoxy-4-quinazolinamine
Description:
6-Methoxy-4-quinazolinamine is a chemical compound characterized by its quinazoline core structure, which consists of a fused benzene and pyrimidine ring. This compound features a methoxy group (-OCH3) at the 6-position and an amino group (-NH2) at the 4-position of the quinazoline ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar organic solvents. The presence of the methoxy and amino functional groups can influence its reactivity, making it a candidate for various chemical reactions, including substitutions and coupling reactions. This compound may also possess pharmacological properties, as quinazoline derivatives are often explored for their roles in medicinal chemistry, particularly in the development of anti-cancer and anti-inflammatory agents. However, specific biological activities and applications would require further investigation through experimental studies. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C9H9N3O
InChI:InChI=1S/C9H9N3O/c1-13-6-2-3-8-7(4-6)9(10)12-5-11-8/h2-5H,1H3,(H2,10,11,12)
InChI key:InChIKey=QVBPHARYACNVKM-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=CC(OC)=C2)N=CN1
Synonyms:- 4-Quinazolinamine, 6-Methoxy-
- 6-Methoxy-4-quinazolinamine
- 6-Methoxy-Quinazolin-4-Ylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
