CymitQuimica logo

CAS 885277-53-2

:

4-Chloro-2-(2-fluorophenyl)-6-methylquinazoline

Description:
4-Chloro-2-(2-fluorophenyl)-6-methylquinazoline is a synthetic organic compound belonging to the quinazoline class, characterized by a fused bicyclic structure containing a benzene ring and a pyrimidine ring. This compound features a chloro substituent at the 4-position, a fluorophenyl group at the 2-position, and a methyl group at the 6-position of the quinazoline ring. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen atoms, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of the compound. Additionally, quinazolines are known for their diverse pharmacological properties, including anti-cancer and anti-inflammatory activities. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C15H10ClFN2
InChI:InChI=1S/C15H10ClFN2/c1-9-6-7-13-11(8-9)14(16)19-15(18-13)10-4-2-3-5-12(10)17/h2-8H,1H3
InChI key:InChIKey=DOIURJRDMJCUSB-UHFFFAOYSA-N
SMILES:FC1=C(C2=NC3=C(C(Cl)=N2)C=C(C)C=C3)C=CC=C1
Synonyms:
  • 4-Chloro-2-(2-Fluoro-Phenyl)-6-Methyl-Quinazoline
  • 4-Chloro-2-(2-fluorophenyl)-6-methylquinazoline
  • Quinazoline, 4-chloro-2-(2-fluorophenyl)-6-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.