CAS 885277-64-5
:3-Amino-1-pyrrolidineacetic acid
Description:
3-Amino-1-pyrrolidineacetic acid, with the CAS number 885277-64-5, is an organic compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features an amino group and an acetic acid moiety, contributing to its potential as a building block in pharmaceutical synthesis and medicinal chemistry. The presence of the amino group suggests that it can participate in various chemical reactions, such as amide formation or nucleophilic substitutions. Its structure may impart specific biological activities, making it of interest in drug development. The compound is likely to be soluble in polar solvents due to the presence of both the amino and carboxylic acid functional groups. Additionally, its molecular properties may allow it to interact with biological systems, potentially influencing neurotransmitter pathways or other physiological processes. As with many amino acids and their derivatives, it may exhibit zwitterionic behavior, depending on the pH of the environment. Overall, 3-Amino-1-pyrrolidineacetic acid represents a versatile compound with applications in various fields of chemistry and biology.
Formula:C6H12N2O2
InChI:InChI=1S/C6H12N2O2/c7-5-1-2-8(3-5)4-6(9)10/h5H,1-4,7H2,(H,9,10)
InChI key:InChIKey=CVERFTFADAXMTR-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CC(N)CC1
Synonyms:- (3-Aminopyrrolidin-1-Yl)Acetic Acid
- 1-Pyrrolidineacetic Acid, 3-Amino-
- 3-Amino-1-pyrrolidineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
