CAS 885277-69-0
:4-Chloro-2-(4-chlorophenyl)-6-methylquinazoline
Description:
4-Chloro-2-(4-chlorophenyl)-6-methylquinazoline is a synthetic organic compound belonging to the quinazoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyrimidine ring. This compound features two chlorine substituents, one at the 4-position of the phenyl group and another at the 4-position of the quinazoline ring, which can influence its reactivity and biological activity. The presence of a methyl group at the 6-position contributes to its overall hydrophobic character. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-cancer and anti-inflammatory activities. Its molecular structure allows for interactions with various biological targets, making it a candidate for further research in drug development. As with many halogenated compounds, it may exhibit unique solubility and stability characteristics, which are important for its application in various chemical and biological contexts. Safety and handling precautions should be observed due to the presence of chlorine atoms, which can pose environmental and health risks.
Formula:C15H10Cl2N2
InChI:InChI=1S/C15H10Cl2N2/c1-9-2-7-13-12(8-9)14(17)19-15(18-13)10-3-5-11(16)6-4-10/h2-8H,1H3
InChI key:InChIKey=FQAGOXLBNSMBFS-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC2=C1C=C(C)C=C2)C3=CC=C(Cl)C=C3
Synonyms:- Quinazoline, 4-chloro-2-(4-chlorophenyl)-6-methyl-
- 4-Chloro-2-(4-chlorophenyl)-6-methylquinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
