CAS 885277-78-1
:4-Chloro-2-(4-chlorophenyl)-5-methylquinazoline
Description:
4-Chloro-2-(4-chlorophenyl)-5-methylquinazoline is a synthetic organic compound belonging to the quinazoline class of heterocyclic compounds. It features a quinazoline core, which is a bicyclic structure composed of a benzene ring fused to a pyrimidine ring. The presence of chlorine substituents at the 4-position of both the quinazoline and the phenyl group enhances its chemical reactivity and may influence its biological activity. The methyl group at the 5-position contributes to the compound's overall hydrophobic character. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including anti-cancer and anti-inflammatory activities. Its molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C15H10Cl2N2
InChI:InChI=1S/C15H10Cl2N2/c1-9-3-2-4-12-13(9)14(17)19-15(18-12)10-5-7-11(16)8-6-10/h2-8H,1H3
InChI key:InChIKey=JLRUACUTKLKJFI-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(N1)C3=CC=C(Cl)C=C3)C=CC=C2C
Synonyms:- 4-Chloro-2-(4-chlorophenyl)-5-methylquinazoline
- Quinazoline, 4-chloro-2-(4-chlorophenyl)-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
