CAS 885277-84-9
:2-[5-(2-Pyrrolidinyl)-1,2,4-oxadiazol-3-yl]pyridine
Description:
2-[5-(2-Pyrrolidinyl)-1,2,4-oxadiazol-3-yl]pyridine, with the CAS number 885277-84-9, is a chemical compound characterized by its unique structure that includes a pyridine ring and an oxadiazole moiety. The presence of the pyrrolidine group contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the oxadiazole ring is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. As with many synthetic compounds, safety and handling precautions are essential, as the specific toxicity and reactivity profiles would need to be assessed through experimental studies. Overall, this compound represents a class of heterocyclic compounds that are valuable in drug discovery and development.
Formula:C11H12N4O
InChI:InChI=1S/C11H12N4O/c1-2-6-12-8(4-1)10-14-11(16-15-10)9-5-3-7-13-9/h1-2,4,6,9,13H,3,5,7H2
InChI key:InChIKey=KZBYZQKJWLTIKT-UHFFFAOYSA-N
SMILES:C1(=NC(=NO1)C2=CC=CC=N2)C3CCCN3
Synonyms:- 2-[5-(2-Pyrrolidinyl)-1,2,4-oxadiazol-3-yl]pyridine
- Pyridine, 2-[5-(2-pyrrolidinyl)-1,2,4-oxadiazol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
