CAS 885277-90-7
:5-fluoro-2-pyrrolidin-2-yl-1H-benzimidazole
Description:
5-Fluoro-2-pyrrolidin-2-yl-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a fluorine atom and a pyrrolidine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, which may influence its pharmacokinetic properties. The pyrrolidine ring contributes to the compound's conformational flexibility, potentially affecting its binding affinity and selectivity for specific receptors or enzymes. As a benzimidazole derivative, it may also exhibit properties relevant to medicinal chemistry, such as antimicrobial, antiviral, or anticancer activities. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 5-fluoro-2-pyrrolidin-2-yl-1H-benzimidazole represents a class of compounds with significant potential for further research and application in pharmaceuticals.
Formula:C11H12FN3
InChI:InChI=1/C11H12FN3/c12-7-3-4-8-10(6-7)15-11(14-8)9-2-1-5-13-9/h3-4,6,9,13H,1-2,5H2,(H,14,15)
SMILES:C1CC(c2nc3ccc(cc3[nH]2)F)NC1
Synonyms:- 1H-benzimidazole, 5-fluoro-2-(2-pyrrolidinyl)-
- 5-fluoro-2-(pyrrolidin-2-yl)-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
