CymitQuimica logo

CAS 885277-92-9

:

7-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid

Description:
7-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a trifluoromethoxy group (-OCF3) at the 7-position enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The carboxylic acid functional group at the 3-position contributes to its acidity and potential for forming salts or esters. This compound is typically used in medicinal chemistry and may exhibit properties such as anti-inflammatory or anti-cancer activities, although specific biological effects would depend on further studies. Its molecular structure allows for various interactions with biological targets, making it a candidate for drug development. Additionally, the trifluoromethoxy group can improve metabolic stability and bioavailability. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H5F3N2O3
InChI:InChI=1S/C9H5F3N2O3/c10-9(11,12)17-5-3-1-2-4-6(5)13-14-7(4)8(15)16/h1-3H,(H,13,14)(H,15,16)
InChI key:InChIKey=LAJOFHIWXSUJIE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=C(OC(F)(F)F)C=CC2)NN1
Synonyms:
  • 1H-Indazole-3-carboxylic acid, 7-(trifluoromethoxy)-
  • 7-Trifluoromethoxy-1H-Indazole-3-Carboxylic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.