CAS 885277-95-2
:Phenylmethyl N-(3-amino-1-methylpropyl)carbamate
Description:
Phenylmethyl N-(3-amino-1-methylpropyl)carbamate, identified by its CAS number 885277-95-2, is a chemical compound that belongs to the class of carbamates. This substance typically features a phenylmethyl group attached to a carbamate functional group, which is further substituted with an amino group linked to a branched alkyl chain. The presence of the amino group suggests potential for hydrogen bonding and reactivity, which may influence its solubility and interaction with biological systems. The molecular structure indicates that it may exhibit properties such as moderate polarity, which can affect its solubility in various solvents. Additionally, compounds of this nature often have applications in medicinal chemistry, potentially serving as intermediates or active pharmaceutical ingredients due to their ability to interact with biological targets. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with exposure. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.
Formula:C12H18N2O2
InChI:InChI=1S/C12H18N2O2/c1-10(7-8-13)14-12(15)16-9-11-5-3-2-4-6-11/h2-6,10H,7-9,13H2,1H3,(H,14,15)
InChI key:InChIKey=WOKDIYCOYIKOQP-UHFFFAOYSA-N
SMILES:C(OC(NC(CCN)C)=O)C1=CC=CC=C1
Synonyms:- (3-Amino-1-methylpropyl)carbamic acid benzyl ester
- Carbamic acid, (3-amino-1-methylpropyl)-, phenylmethyl ester
- Carbamic acid, N-(3-amino-1-methylpropyl)-, phenylmethyl ester
- Phenylmethyl N-(3-amino-1-methylpropyl)carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
