CAS 885278-00-2
:6-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole
Description:
6-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a methyl group and a pyrrolidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the pyrrolidine ring may contribute to its pharmacological properties, making it of interest in medicinal chemistry. The benzimidazole framework is known for its role in various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the methyl substitution can influence the compound's lipophilicity and overall reactivity. As with many organic compounds, its stability, reactivity, and interaction with biological systems can be influenced by environmental factors such as pH and temperature. Overall, 6-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C12H15N3
InChI:InChI=1S/C12H15N3/c1-8-4-5-9-11(7-8)15-12(14-9)10-3-2-6-13-10/h4-5,7,10,13H,2-3,6H2,1H3,(H,14,15)
InChI key:InChIKey=GHTGLFGDGAUKFP-UHFFFAOYSA-N
SMILES:CC=1C=C2N=C(NC2=CC1)C3CCCN3
Synonyms:- 1H-Benzimidazole, 5-methyl-2-(2-pyrrolidinyl)-
- 1H-benzimidazole, 6-methyl-2-(2-pyrrolidinyl)-
- 5-methyl-2-(pyrrolidin-2-yl)-1H-benzimidazole
- 6-Methyl-2-(2-pyrrolidinyl)-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Methyl-2-pyrrolidin-2-yl-1H-benzimidazole dihydrochloride
CAS:Formula:C12H15N3Molecular weight:201.2676
