CAS 885278-15-9

[4-(2-{[(Benzyloxy)carbonyl]amino}ethyl)phenyl]acetic acid

Description:

The chemical substance known as [4-(2-{[(Benzyloxy)carbonyl]amino}ethyl)phenyl]acetic acid, with the CAS number 885278-15-9, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring, an acetic acid moiety, and a benzyloxycarbonyl group. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential solubility in organic solvents. The presence of the benzyloxycarbonyl group suggests that it may be used as a protective group in peptide synthesis or other organic reactions. Additionally, the amino group in its structure indicates potential for biological activity, possibly interacting with various biological targets. The compound's molecular interactions may be influenced by its ability to form hydrogen bonds and engage in π-π stacking due to the aromatic components. Overall, this substance may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as an intermediate in organic synthesis.

Formula: C₁₈H₁₉NO₄

InChI: InChI=1/C18H19NO4/c20-17(21)12-15-8-6-14(7-9-15)10-11-19-18(22)23-13-16-4-2-1-3-5-16/h1-9H,10-13H2,(H,19,22)(H,20,21)