CAS 885278-16-0
:1,6-Naphthyridine-8-carboxaldehyde
Description:
1,6-Naphthyridine-8-carboxaldehyde is a heterocyclic organic compound characterized by a naphthyridine core, which consists of a fused bicyclic structure containing nitrogen atoms. This compound features a carboxaldehyde functional group (-CHO) at the 8-position of the naphthyridine ring, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a crystalline solid and is soluble in polar organic solvents. The presence of the aldehyde group allows for various chemical reactions, including condensation and oxidation, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the nitrogen atoms in the naphthyridine structure can participate in coordination chemistry, potentially forming complexes with metal ions. Its unique structure and functional groups make it of interest in medicinal chemistry, particularly for the development of compounds with biological activity. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H6N2O
InChI:InChI=1S/C9H6N2O/c12-6-8-5-10-4-7-2-1-3-11-9(7)8/h1-6H
InChI key:InChIKey=RBNHLMJPAYWTHH-UHFFFAOYSA-N
SMILES:C(=O)C=1C2=C(C=NC1)C=CC=N2
Synonyms:- 1,6-Naphthyridine-8-Carbaldehyde
- 1,6-Naphthyridine-8-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
