CAS 885278-21-7
:2,3-Dihydro-7-methoxy-3-benzofuranamine
Description:
2,3-Dihydro-7-methoxy-3-benzofuranamine is a chemical compound characterized by its unique structure, which includes a benzofuran moiety and an amine functional group. This compound features a methoxy group at the 7-position of the benzofuran ring, contributing to its potential biological activity. The presence of the dihydro group indicates that it has a saturated bond in the furan ring, which can influence its reactivity and stability. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. As with many organic compounds, the synthesis and characterization of 2,3-Dihydro-7-methoxy-3-benzofuranamine would be essential for understanding its potential uses and effects in various chemical and biological contexts.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c1-11-8-4-2-3-6-7(10)5-12-9(6)8/h2-4,7H,5,10H2,1H3
InChI key:InChIKey=VXCOSBXVTCJRSD-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C(N)CO2)=CC=C1
Synonyms:- 2,3-Dihydro-7-methoxy-3-benzofuranamine
- 7-Methoxy-2,3-Dihydro-Benzofuran-3-Ylamine Hydrochloride
- 3-Benzofuranamine, 2,3-dihydro-7-methoxy-
- 7-Methoxy-2,3-dihydrobenzofuran-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
