CAS 885278-25-1
:3-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenol
Description:
3-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenol, with the CAS number 885278-25-1, is a chemical compound characterized by its complex structure, which includes a phenolic group and a tetrazole moiety. The presence of the triphenylmethyl group contributes to its stability and lipophilicity, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. The tetrazole ring is known for its bioactivity and can participate in various chemical reactions, enhancing the compound's versatility. This substance may exhibit interesting properties such as antioxidant activity, and its phenolic nature suggests potential interactions with biological systems. Additionally, the compound's solubility and reactivity can be influenced by the substituents on the phenolic and tetrazole rings. Overall, 3-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenol represents a unique chemical entity with potential applications in medicinal chemistry and materials science, warranting further investigation into its properties and uses.
Formula:C26H20N4O
InChI:InChI=1S/C26H20N4O/c31-24-18-10-11-20(19-24)25-27-29-30(28-25)26(21-12-4-1-5-13-21,22-14-6-2-7-15-22)23-16-8-3-9-17-23/h1-19,31H
InChI key:InChIKey=MIDUJJHWBFKQEM-UHFFFAOYSA-N
SMILES:C(N1N=C(N=N1)C2=CC(O)=CC=C2)(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:- 3-(2-TRITYL-2H-TETRAZOL-5-YL)-PHENOL
- Phenol, 3-[2-(triphenylmethyl)-2H-tetrazol-5-yl]-
- 3-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
