CAS 885278-28-4
:1-(Triphenylmethyl)-1H-tetrazole-5-methanamine
Description:
1-(Triphenylmethyl)-1H-tetrazole-5-methanamine, with the CAS number 885278-28-4, is a chemical compound characterized by its unique structure that includes a tetrazole ring and a triphenylmethyl group. The tetrazole moiety contributes to its potential as a bioactive compound, often exhibiting properties such as antimicrobial or antifungal activity. The presence of the triphenylmethyl group enhances its stability and lipophilicity, which can influence its solubility and interaction with biological systems. This compound may also exhibit interesting electronic properties due to the conjugated system formed by the phenyl groups. In terms of reactivity, tetrazoles are known for their ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Overall, 1-(Triphenylmethyl)-1H-tetrazole-5-methanamine represents a class of compounds that can be explored for applications in medicinal chemistry and materials science, although specific biological activities and applications would require further investigation.
Formula:C21H19N5
InChI:InChI=1S/C21H19N5/c22-16-20-23-24-25-26(20)21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15H,16,22H2
InChI key:InChIKey=IUGOPUGMYSNRTE-UHFFFAOYSA-N
SMILES:C(N1C(CN)=NN=N1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- (1-Trityl-1H-tetrazol-5-yl)methanamine
- (1-Trityltetrazol-5-yl)methanamine
- 1-(Triphenylmethyl)-1H-tetrazole-5-methanamine
- C-(1-Trityl-1H-Tetrazol-5-Yl)-Methylamine
- 1H-Tetrazole-5-methanamine, 1-(triphenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.