
CAS 885278-37-5
:4-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenol
Description:
4-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenol, with the CAS number 885278-37-5, is a chemical compound characterized by its complex structure, which includes a phenolic group and a tetrazole moiety. The presence of the triphenylmethyl group contributes to its stability and lipophilicity, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. The tetrazole ring is known for its bioactivity and can participate in various chemical reactions, enhancing the compound's versatility. This substance may exhibit interesting properties such as solubility in organic solvents and potential interactions with biological targets due to its functional groups. Its unique structure may also allow for specific reactivity patterns, making it a candidate for further research in medicinal chemistry or materials science. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in detail for practical applications.
Formula:C26H20N4O
InChI:InChI=1S/C26H20N4O/c31-24-18-16-20(17-19-24)25-27-29-30(28-25)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19,31H
InChI key:InChIKey=RVOUIKOXCBVEQP-UHFFFAOYSA-N
SMILES:C(N1N=C(N=N1)C2=CC=C(O)C=C2)(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:- Phenol, 4-[2-(triphenylmethyl)-2H-tetrazol-5-yl]-
- 4-[2-(Triphenylmethyl)-2H-tetrazol-5-yl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
