CAS 885278-40-0
:3-[[2-(Triphenylmethyl)-2H-tetrazol-5-yl]methyl]phenol
Description:
3-[[2-(Triphenylmethyl)-2H-tetrazol-5-yl]methyl]phenol, with the CAS number 885278-40-0, is a chemical compound characterized by its complex structure, which includes a phenolic group and a tetrazole moiety. The presence of the triphenylmethyl group contributes to its stability and lipophilicity, making it potentially useful in various applications, including pharmaceuticals and organic synthesis. The tetrazole ring is known for its bioactivity and can participate in various chemical reactions, enhancing the compound's versatility. This substance may exhibit interesting properties such as solubility in organic solvents and potential interactions with biological targets, which could be explored in medicinal chemistry. Additionally, the compound's structure suggests it may have applications in materials science or as a ligand in coordination chemistry. Overall, its unique combination of functional groups and structural features makes it a subject of interest for further research and development in various chemical fields.
Formula:C27H22N4O
InChI:InChI=1S/C27H22N4O/c32-25-18-10-11-21(19-25)20-26-28-30-31(29-26)27(22-12-4-1-5-13-22,23-14-6-2-7-15-23)24-16-8-3-9-17-24/h1-19,32H,20H2
InChI key:InChIKey=ANDFDFQROBZCLI-UHFFFAOYSA-N
SMILES:C(N1N=C(CC2=CC(O)=CC=C2)N=N1)(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:- Phenol, 3-[[2-(triphenylmethyl)-2H-tetrazol-5-yl]methyl]-
- 3-[[2-(Triphenylmethyl)-2H-tetrazol-5-yl]methyl]phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
