CymitQuimica logo

CAS 885278-42-2

:

1H-Indazole-3-carboxylic acid, 6-bromo-, methyl ester

Description:
1H-Indazole-3-carboxylic acid, 6-bromo-, methyl ester is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a carboxylic acid functional group at the 3-position and a bromine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. The methyl ester group enhances its solubility and may influence its biological activity. This compound is typically used in research and development, particularly in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, the bromine substituent can serve as a site for further functionalization, enabling the exploration of structure-activity relationships in drug design. Overall, 1H-Indazole-3-carboxylic acid, 6-bromo-, methyl ester is a valuable compound in the field of organic chemistry, with potential implications in various scientific applications.
Formula:C9H7BrN2O2
InChI:InChI=1/C9H7BrN2O2/c1-14-9(13)8-6-3-2-5(10)4-7(6)11-12-8/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=FIPMZRPZSZXFGK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(NN1)=CC(Br)=CC2
Synonyms:
  • 1H-indazole-3-carboxylic acid, 6-bromo-, methyl ester
  • 6-Bromo-1H-indazole-3-carboxylic acid methyl ester
  • 6-Bromoindazole-3-carboxylic acid methyl ester
  • Methyl 6-bromo-1H-indazole-3-carboxylate
  • Methyl 6-bromo-1H-indazole-3-carboxylate
  • 6-Bromo-3-(methoxycarbonyl)-1H-indazole
Found 3 products.