CAS 885278-45-5
:Ethyl 5-amino-1H-indazole-3-carboxylate
Description:
Ethyl 5-amino-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features an amino group (-NH2) at the 5-position and an ethyl ester group at the 3-position, contributing to its reactivity and solubility properties. It is typically a white to off-white solid, and its molecular structure allows for potential interactions with biological systems, making it of interest in pharmaceutical research. The presence of the carboxylate group enhances its ability to participate in various chemical reactions, such as esterification and amidation. Ethyl 5-amino-1H-indazole-3-carboxylate may exhibit biological activity, which could include antimicrobial or anticancer properties, although specific biological data would depend on experimental studies. As with many organic compounds, proper handling and safety measures should be observed due to potential toxicity or reactivity.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-2-15-10(14)9-7-5-6(11)3-4-8(7)12-13-9/h3-5H,2,11H2,1H3,(H,12,13)
InChI key:InChIKey=JKJIVTRCPQYSDH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(NN1)=CC=C(N)C2
Synonyms:- 1H-Indazole-3-carboxylic acid, 5-amino-, ethyl ester
- Ethyl 5-Amino-1H-Indazole-3-Carboxylate
- 5-amino-3-ethoxycarbonyl-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
