CAS 885278-51-3
:Ethyl 2-(2-methylphenyl)-4-thiazolecarboxylate
Description:
Ethyl 2-(2-methylphenyl)-4-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the 2-methylphenyl group indicates that it has a substituted aromatic ring, which can influence its reactivity and interaction with biological systems. Ethyl 2-(2-methylphenyl)-4-thiazolecarboxylate is typically used in synthetic organic chemistry, potentially serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its thiazole moiety may impart biological activity, making it of interest in medicinal chemistry. The compound's properties, such as melting point, boiling point, and specific reactivity, would depend on its molecular structure and the presence of functional groups. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.
Formula:C13H13NO2S
InChI:InChI=1S/C13H13NO2S/c1-3-16-13(15)11-8-17-12(14-11)10-7-5-4-6-9(10)2/h4-8H,3H2,1-2H3
InChI key:InChIKey=FTIWJDSCQBOTIM-UHFFFAOYSA-N
SMILES:CC1=C(C2=NC(C(OCC)=O)=CS2)C=CC=C1
Synonyms:- 2-(O-Tolyl)-Thiazole-4-Carboxylic Acid Ethyl Ester
- 4-Thiazolecarboxylic acid, 2-(2-methylphenyl)-, ethyl ester
- Ethyl 2-(2-methylphenyl)-4-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
